For research use only. Not for therapeutic Use.
2,4,6-Tris((trimethylsilyl)ethynyl)-1,3,5-triazine(Cat No.:L002944)is a specialized compound used in advanced materials science and organic synthesis. This triazine derivative, featuring three trimethylsilyl-ethynyl groups, is valuable for constructing complex molecular architectures, particularly in the development of polymers, electronic materials, and functionalized surfaces. Its unique structure allows for diverse chemical reactions, including cross-coupling and polymerization processes. With high purity and reactivity, 2,4,6-Tris((trimethylsilyl)ethynyl)-1,3,5-triazine supports innovative research in materials science, enabling the creation of novel compounds with advanced properties for various high-tech applications.
Catalog Number | L002944 |
CAS Number | 155202-89-4 |
Molecular Formula | C18H27N3Si3 |
Purity | ≥95% |
IUPAC Name | 2-[4,6-bis(2-trimethylsilylethynyl)-1,3,5-triazin-2-yl]ethynyl-trimethylsilane |
InChI | InChI=1S/C18H27N3Si3/c1-22(2,3)13-10-16-19-17(11-14-23(4,5)6)21-18(20-16)12-15-24(7,8)9/h1-9H3 |
InChIKey | VJRBNAFAIOIOKW-UHFFFAOYSA-N |
SMILES | C[Si](C)(C)C#CC1=NC(=NC(=N1)C#C[Si](C)(C)C)C#C[Si](C)(C)C |