For research use only. Not for therapeutic Use.
2,4,6,8-Tetrahydroxypyrimido[5,4-d]pyrimidine(Cat No.:L038817)is a polyhydroxylated heterocyclic compound featuring a fused pyrimido-pyrimidine ring system with hydroxyl groups at the 2, 4, 6, and 8 positions. This compound is significant in pharmaceutical research and biochemistry, often studied for its potential biological activities and as a building block in the synthesis of nucleic acid analogs. Its structure is related to purine and pyrimidine bases, making it useful in exploring enzyme interactions and metabolic pathways. High purity ensures its effectiveness in advanced research applications, particularly in medicinal chemistry and drug development.
CAS Number | 6713-54-8 |
Molecular Formula | C6H4N4O4 |
Purity | ≥95% |
IUPAC Name | 1,5-dihydropyrimido[5,4-d]pyrimidine-2,4,6,8-tetrone |
InChI | InChI=1S/C6H4N4O4/c11-3-1-2(8-6(14)9-3)4(12)10-5(13)7-1/h(H2,7,10,12,13)(H2,8,9,11,14) |
InChIKey | ZEKJTVBUDUYZOU-UHFFFAOYSA-N |
SMILES | C12=C(C(=O)NC(=O)N1)NC(=O)NC2=O |