For research use only. Not for therapeutic Use.
2,4,8,10-Tetraoxaspiro[5.5]undecane(Cat No.:M071405), also known as tetraoxaspiroundecane, is a cyclic organic compound characterized by a spiro (bridged) structure composed of eleven carbon atoms and four oxygen atoms. It possesses a unique molecular arrangement, featuring two spirocyclic rings fused with oxygen atoms. This compound exhibits interesting properties, including high thermal stability and solubility in various organic solvents. Tetraoxaspiro[5.5]undecane finds application as a building block in organic synthesis, particularly in the design and fabrication of macrocyclic compounds, supramolecular assemblies, and functional materials, contributing to advancements in diverse areas of chemistry and materials science.
CAS Number | 126-54-5 |
Molecular Formula | C7H12O4 |
Purity | ≥95% |
Storage | 3 years -20C powder |
IUPAC Name | 2,4,8,10-tetraoxaspiro[5.5]undecane |
InChI | InChI=1S/C7H12O4/c1-7(2-9-5-8-1)3-10-6-11-4-7/h1-6H2 |
InChIKey | BGCSUUSPRCDKBQ-UHFFFAOYSA-N |
SMILES | C1C2(COCO1)COCOC2 |