For research use only. Not for therapeutic Use.
24(R)-Hydroxycholesterol (Cat No.: R063938) is a metabolite of cholesterol, primarily produced in the brain by the enzyme cholesterol 24-hydroxylase. It serves as a signaling molecule, influencing neuronal function and brain cholesterol homeostasis. It also plays a role in neuroprotection, inflammation regulation, and the modulation of neurodegenerative diseases like Alzheimer’s. Additionally, 24(R)-hydroxycholesterol is involved in cholesterol efflux, helping to maintain cholesterol balance within the central nervous system. It may also serve as a biomarker for certain neurological disorders.
CAS Number | 27460-26-0 |
Synonyms | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
Molecular Formula | C27H46O2 |
Purity | ≥95% |
InChI | InChI=1S/C27H46O2/c1-17(2)25(29)11-6-18(3)22-9-10-23-21-8-7-19-16-20(28)12-14-26(19,4)24(21)13-15-27(22,23)5/h7,17-18,20-25,28-29H,6,8-16H2,1-5H3/t18-,20+,21+,22-,23+,24+,25-,26+,27-/m1/s1 |
InChIKey | IOWMKBFJCNLRTC-RNCHBCSGSA-N |
SMILES | CC(C)C(CCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)O |
Reference | [1]. Zhao H, et, al. Investigation on the synthesis of 24-(R)-hydroxycholesterol. Steroids. 2023 Jul:195:109227. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |