For research use only. Not for therapeutic Use.
2,5-Anhydro-D-mannose(Cat No.:R002444) is a rare sugar that plays important roles in biological processes. It is a component of bacterial and plant cell wall polysaccharides, such as alginate and pectin, where it contributes to structural integrity. In mammals, 2,5-anhydro-D-mannose is involved in glycoprotein biosynthesis, particularly in the synthesis of glycosaminoglycans and glycolipids. It also serves as a precursor for the synthesis of other important sugars. Due to its limited availability, 2,5-anhydro-D-mannose has attracted attention for its potential therapeutic applications, particularly in the development of novel antibiotics and anti-inflammatory agents.
CAS Number | 495-75-0 |
Synonyms | Chitose; D-2,5-Anhydromannose; |
Molecular Formula | C6H10O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carbaldehyde |
InChI | InChI=1S/C6H10O5/c7-1-3-5(9)6(10)4(2-8)11-3/h1,3-6,8-10H,2H2/t3-,4-,5-,6-/m1/s1 |
InChIKey | LKAPTZKZHMOIRE-KVTDHHQDSA-N |
SMILES | C(C1C(C(C(O1)C=O)O)O)O |