For research use only. Not for therapeutic Use.
2,5-Bis(aminomethyl)furan (Cat No.:R006872) is a chemical compound. It is a furan derivative featuring two aminoethyl groups attached to positions 2 and 5 of the furan ring. This compound has potential applications in organic synthesis, particularly as a building block in the preparation of various molecules. Its unique structure makes it useful for creating complex organic compounds, such as polymers, pharmaceuticals, and specialty chemicals.
CAS Number | 2213-51-6 |
Synonyms | Aminomethyl-5 Furfurylamine-2; C-(5-Aminomethyl-furan-2-yl)-methylamine; |
Molecular Formula | C6H10N2O |
Purity | 95% |
Appearance | Liquid |
Storage | 2–8 °C |
IUPAC Name | [5-(aminomethyl)furan-2-yl]methanamine |
InChI | InChI=1S/C6H10N2O/c7-3-5-1-2-6(4-8)9-5/h1-2H,3-4,7-8H2 |
InChIKey | VKLGKDZCKSMSHG-UHFFFAOYSA-N |
SMILES | C1=C(OC(=C1)CN)CN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |