For research use only. Not for therapeutic Use.
2,5-Bis(dimethylamino)cyclohexa-2,5-diene-1,4-dione(Cat No.:M048326) is a chemical compound featuring a cyclohexadiene ring with two ketone groups at the 1 and 4 positions and two dimethylamino groups at the 2 and 5 positions. This structure gives it unique electronic properties and reactivity, making it of interest in organic synthesis. It acts as an electron donor in various chemical reactions, including those involving electron-rich compounds. Its ability to participate in complex formations with metals and other electrophiles makes it a useful ligand in coordination chemistry, potentially leading to applications in catalysis and materials science.
CAS Number | 1521-02-4 |
Synonyms | 2,5-Bis(dimethylamino)cyclohexa-2,5-diene-1,4-dione; |
Molecular Formula | C10H14N2O2 |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | 2,5-bis(dimethylamino)cyclohexa-2,5-diene-1,4-dione |
InChI | InChI=1S/C10H14N2O2/c1-11(2)7-5-10(14)8(12(3)4)6-9(7)13/h5-6H,1-4H3 |
InChIKey | BZZIJKWURTYMLH-UHFFFAOYSA-N |
SMILES | CN(C)C1=CC(=O)C(=CC1=O)N(C)C |