For research use only. Not for therapeutic Use.
2,5-Bis(4-aminophenyl)-pyrimidine is a heterocyclic compound featuring a pyrimidine ring with two 4-aminophenyl groups attached at the 2- and 5-positions. The amino groups on the phenyl rings provide nucleophilic sites for further chemical reactions, while the pyrimidine ring offers aromatic stability. This structure makes the compound useful as a building block in the synthesis of bioactive molecules, particularly in drug discovery and medicinal chemistry. It may exhibit potential as an anticancer, antimicrobial, or anti-inflammatory agent.
Catalog Number | L002622 |
CAS Number | 102570-64-9 |
Molecular Formula | C16H14N4 |
Purity | ≥95% |
IUPAC Name | 4-[2-(4-aminophenyl)pyrimidin-5-yl]aniline |
InChI | InChI=1S/C16H14N4/c17-14-5-1-11(2-6-14)13-9-19-16(20-10-13)12-3-7-15(18)8-4-12/h1-10H,17-18H2 |
InChIKey | LJQRDZHDYMOIIO-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=CN=C(N=C2)C3=CC=C(C=C3)N)N |