2,5-Bis(hydroxymethyl)oxolane-2,3,4-triol (Cat.No:L003925) is a crucial compound in biochemistry. Commonly known as D-Trehalose, it is a disaccharide found in various organisms, including bacteria and insects, acting as a protective agent against environmental stress. Its unique structure and biological significance have led to its use in pharmaceuticals and food industries, highlighting its importance in modern biotechnology and healthcare.
| Catalog Number | L003925 |
| CAS Number | 53188-23-1 |
| Molecular Formula | C6H12O6 |
| Purity | ≥95% |
| IUPAC Name | 2,5-bis(hydroxymethyl)oxolane-2,3,4-triol |
| InChI | InChI=1S/C6H12O6/c7-1-3-4(9)5(10)6(11,2-8)12-3/h3-5,7-11H,1-2H2 |
| InChIKey | RFSUNEUAIZKAJO-UHFFFAOYSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@](O1)(CO)O)O)O)O |
