For research use only. Not for therapeutic Use.
2,5-Diaminopyrimidine（Cat No.:L023344）is a key intermediate in pharmaceutical research and organic synthesis. Featuring two amino groups on a pyrimidine ring, this compound is integral to the development of various bioactive molecules, including antiviral, anticancer, and antimicrobial agents. Its versatile structure allows for a wide range of chemical modifications, making it valuable in medicinal chemistry for the synthesis of complex heterocyclic compounds. With high purity and consistent quality, 2,5-Diaminopyrimidine supports innovative drug discovery and the development of new therapeutic agents.
| Catalog Number | L023344 |
| CAS Number | 22715-27-1 |
| Molecular Formula | C4H6N4 |
| Purity | ≥95% |
| IUPAC Name | pyrimidine-2,5-diamine |
| InChI | InChI=1S/C4H6N4/c5-3-1-7-4(6)8-2-3/h1-2H,5H2,(H2,6,7,8) |
| InChIKey | DNACGYGXUFTEHO-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)N)N |
