For research use only. Not for therapeutic Use.
2,5-Dibromo-1,3-dimethylbenzene(Cat No.:L017611)is an aromatic compound characterized by two bromine atoms and two methyl groups attached to a benzene ring. This compound is valuable in organic synthesis, particularly in the production of pharmaceuticals, agrochemicals, and advanced materials. The presence of bromine atoms provides sites for further functionalization, making it a versatile intermediate for creating complex molecular structures. Its well-defined reactivity and stability make it a crucial building block for researchers developing new compounds with potential applications in various chemical industries.
CAS Number | 100189-84-2 |
Molecular Formula | C8H8Br2 |
Purity | ≥95% |
IUPAC Name | 2,5-dibromo-1,3-dimethylbenzene |
InChI | InChI=1S/C8H8Br2/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3 |
InChIKey | XXFGKGMZLZIPCN-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=C1Br)C)Br |