For research use only. Not for therapeutic Use.
2,5-Dibromothioanisole(Cat No.:L010125)is a brominated aromatic compound featuring bromine atoms at the 2 and 5 positions on a thioanisole core. This compound is widely used in organic synthesis and pharmaceutical research as an intermediate in the production of bioactive molecules and advanced materials. The presence of bromine atoms allows for further functionalization through cross-coupling reactions, making it a valuable building block in the synthesis of complex molecular structures. Its high reactivity and purity ensure consistent performance in medicinal chemistry, material science, and other advanced research applications.
CAS Number | 134646-03-0 |
Molecular Formula | C7H6Br2S |
Purity | ≥95% |
IUPAC Name | 1,4-dibromo-2-methylsulfanylbenzene |
InChI | InChI=1S/C7H6Br2S/c1-10-7-4-5(8)2-3-6(7)9/h2-4H,1H3 |
InChIKey | FJWOCBXOKSWZPN-UHFFFAOYSA-N |
SMILES | CSC1=C(C=CC(=C1)Br)Br |