For research use only. Not for therapeutic Use.
2,5-Dibromothiophene-3-carboxylic Acid(Cat No.:L042402)is an essential chemical intermediate prominently utilized in the synthesis of organic electronics and pharmaceuticals. The thiophene ring, a sulfur-containing heterocycle, provides electronic properties desirable for conductive materials. The dibromo groups at the 2 and 5 positions significantly enhance the compound’s reactivity, making it ideal for various cross-coupling reactions essential in constructing polymeric and small molecule frameworks. Additionally, the carboxylic acid functionality at the 3-position allows for further derivatization, enabling the synthesis of more complex molecules, crucial for developing advanced materials and bioactive compounds.
CAS Number | 7311-70-8 |
Molecular Formula | C5H2Br2O2S |
Purity | ≥95% |
IUPAC Name | 2,5-dibromothiophene-3-carboxylic acid |
InChI | InChI=1S/C5H2Br2O2S/c6-3-1-2(5(8)9)4(7)10-3/h1H,(H,8,9) |
InChIKey | PZBUYFPAASJYSI-UHFFFAOYSA-N |
SMILES | C1=C(SC(=C1C(=O)O)Br)Br |