For research use only. Not for therapeutic Use.
2,5-Dichloroterephthalic acid(Cat No.:M058040) is a halogenated derivative of terephthalic acid, characterized by the presence of two chlorine atoms on the benzene ring. This organic compound, with the formula C8H4Cl2O4, appears as a white crystalline solid and is known for its role as a precursor in the synthesis of more complex chemicals. It is particularly valuable in the polymer industry for producing high-performance polymers and resins, such as polyesters and polyamides, which exhibit enhanced thermal stability and chemical resistance due to the chlorine substituents. Its uses extend to coatings, plastics, and flame retardants.
CAS Number | 13799-90-1 |
Molecular Formula | C8H4Cl2O4 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2,5-dichloroterephthalic acid |
InChI | InChI=1S/C8H4Cl2O4/c9-5-1-3(7(11)12)6(10)2-4(5)8(13)14/h1-2H,(H,11,12)(H,13,14) |
InChIKey | LMOSYFZLPBHEOW-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1Cl)C(=O)O)Cl)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |