For research use only. Not for therapeutic Use.
2,5-Dichlorothiazole(Cat No.:L006678), is a chemical compound featuring a thiazole ring with chlorine atoms at the 2nd and 5th positions. Thiazoles are essential heterocyclic compounds with diverse applications in pharmaceuticals, agrochemicals, and materials science. Compounds like 2,5-dichlorothiazole serve as crucial intermediates in the synthesis of various chemicals, including fungicides and pharmaceuticals. Their unique ring structure and reactivity make them valuable in organic synthesis, contributing significantly to the development of compounds used in both research and industrial applications.
CAS Number | 16629-14-4 |
Molecular Formula | C3HCl2NS |
Purity | ≥95% |
IUPAC Name | 2,5-dichloro-1,3-thiazole |
InChI | InChI=1S/C3HCl2NS/c4-2-1-6-3(5)7-2/h1H |
InChIKey | XPJACWOWEJJYRD-UHFFFAOYSA-N |
SMILES | C1=C(SC(=N1)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |