For research use only. Not for therapeutic Use.
2/’,5/’-Dideoxyadenosine(CAT: I011421) is a synthetic nucleoside analog that lacks a hydroxyl group at the 3′ position of the ribose sugar, which is essential for the formation of the phosphodiester bond required for DNA and RNA synthesis. 2′,5′-Dideoxyadenosine is phosphorylated by cellular kinases to its triphosphate form, which competes with the natural nucleotide adenosine triphosphate (ATP) for incorporation into viral DNA during viral replication. This property has led to its use in research and the development of pharmaceuticals for the treatment of viral infections, such as hepatitis B and HIV.
| Catalog Number | I011421 |
| CAS Number | 6698-26-6 |
| Synonyms | 2/’,5/’-dideoxy-adenosine |
| Molecular Formula | C₁₀H₁₃N₅O₂ |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| InChI | InChI=1S/C10H13N5O2/c1-5-6(16)2-7(17-5)15-4-14-8-9(11)12-3-13-10(8)15/h3-7,16H,2H2,1H3,(H2,11,12,13)/t5-,6+,7-/m1/s1 |
| InChIKey | FFHPXOJTVQDVMO-DSYKOEDSSA-N |
| SMILES | CC1C(CC(O1)N2C=NC3=C2N=CN=C3N)O |
