For research use only. Not for therapeutic Use.
2,5-Dihydroxyterephthalohydrazide(CAT: L000074) is a notable compound with relevance in organic chemistry and pharmaceutical research. This chemical structure contains a terephthalohydrazide core featuring two hydroxy groups. It is employed as a key building block in the synthesis of various organic compounds, particularly in the development of pharmaceutical agents.
| Catalog Number | L000074 |
| CAS Number | 2245708-24-9 |
| Molecular Formula | C8H10N4O4 |
| Purity | ≥95% |
| IUPAC Name | 2,5-dihydroxybenzene-1,4-dicarbohydrazide |
| InChI | InChI=1S/C8H10N4O4/c9-11-7(15)3-1-5(13)4(2-6(3)14)8(16)12-10/h1-2,13-14H,9-10H2,(H,11,15)(H,12,16) |
| InChIKey | DQZASJMFKRPEEF-UHFFFAOYSA-N |
