Home
>
Materials Science>Organic monomer of COF> 2',5'-Dimethoxy-[1,1':4',1''-terphenyl]-4,4''-dicarbaldehyde
For research use only. Not for therapeutic Use.
2′,5′-Dimethoxy-[1,1′:4′,1”-terphenyl]-4,4”-dicarbaldehyde (Cat.No:L003789) is a pivotal compound in materials science. Its unique terphenyl-based structure provides distinctive reactivity and properties. This compound serves as a valuable intermediate in the synthesis of specialized organic molecules with various industrial and pharmaceutical applications. Its versatility makes it a crucial building block in the development of innovative materials and functionalized compounds, underscoring its significance in contemporary chemical research.
CAS Number | 111759-27-4 |
Molecular Formula | C22H18O4 |
Purity | ≥95% |
IUPAC Name | 4-[4-(4-formylphenyl)-2,5-dimethoxyphenyl]benzaldehyde |
InChI | InChI=1S/C22H18O4/c1-25-21-11-20(18-9-5-16(14-24)6-10-18)22(26-2)12-19(21)17-7-3-15(13-23)4-8-17/h3-14H,1-2H3 |
InChIKey | KWQZYZSJYJLLBI-UHFFFAOYSA-N |
SMILES | COC1=CC(=C(C=C1C2=CC=C(C=C2)C=O)OC)C3=CC=C(C=C3)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |