For research use only. Not for therapeutic Use.
A series of 2,5-<wbr></wbr>phenethylamines, collectively referred to as 2Cs, have psychoactive effects. The most effective 2C compounds are 2,5-<wbr></wbr>dimethoxy-<wbr></wbr>4-<wbr></wbr>substituted phenethylamines; many are regulated as illegal substances. 2C-<wbr></wbr>N is described formally as 2,5-<wbr></wbr>dimethoxy-<wbr></wbr>4-<wbr></wbr>nitrophenethylamine and is structurally analogous to the psychedelic drug 2C-<wbr></wbr>B. 2C-<wbr></wbr>N potently stimulates arachidonic acid release through the serotonin receptors 5-<wbr></wbr>HT<sub>2C</sub> (pEC<sub>50</sub> = 5.91) and 5-<wbr></wbr>HT<sub>2A</sub> (pEC<sub>50</sub> = 4.78). This product is intended for forensic and research applications.
| Catalog Number | R040470 |
| CAS Number | 261789-00-8 |
| Synonyms | 2C-N Hydrochloride; |
| Molecular Formula | C10H14N2O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-(2,5-dimethoxy-4-nitrophenyl)ethanamine |
| InChI | InChI=1S/C10H14N2O4/c1-15-9-6-8(12(13)14)10(16-2)5-7(9)3-4-11/h5-6H,3-4,11H2,1-2H3 |
| InChIKey | ZMUSDZGRRJGRAO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1CCN)OC)[N+](=O)[O-] |
