Home
>
Materials Science>Organic monomer of COF> 2',5'-Dimethyl-[1,1':4',1''-terphenyl]-4,4''-dicarbaldehyde
For research use only. Not for therapeutic Use.
2′,5′-Dimethyl-[1,1′:4′,1”-terphenyl]-4,4”-dicarbaldehyde (Cat.No:L004044) is a pivotal compound in materials science. Its unique terphenyl structure, with two methyl groups and aldehyde functionalities, imparts specialized properties. This compound serves as a valuable building block in the synthesis of tailored polymers and liquid crystals, particularly in electronic applications.
Catalog Number | L004044 |
CAS Number | 857412-04-5 |
Molecular Formula | C22H18O2 |
Purity | ≥95% |
IUPAC Name | 4-[4-(4-formylphenyl)-2,5-dimethylphenyl]benzaldehyde |
InChI | InChI=1S/C22H18O2/c1-15-11-22(20-9-5-18(14-24)6-10-20)16(2)12-21(15)19-7-3-17(13-23)4-8-19/h3-14H,1-2H3 |
InChIKey | UVPAUSVUQTYXKB-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1C2=CC=C(C=C2)C=O)C)C3=CC=C(C=C3)C=O |