For research use only. Not for therapeutic Use.
2,5-Dimethyl-4-nitrobenzoic acid(CAT: L021661) is a high-purity aromatic compound widely employed in pharmaceutical and chemical research. Featuring a benzoic acid core with methyl groups at the 2 and 5 positions and a nitro group at the 4 position, this compound offers unique electronic and structural properties. It serves as a versatile intermediate in the synthesis of bioactive molecules, fine chemicals, and advanced materials. 2,5-Dimethyl-4-nitrobenzoic acid is particularly valuable for medicinal chemistry applications, including drug discovery and the development of enzyme inhibitors. Its stability and reactivity ensure consistent performance in diverse experimental setups, supporting innovative research and chemical development.
CAS Number | 6954-70-7 |
Molecular Formula | C9H9NO4 |
Purity | ≥95% |
IUPAC Name | 2,5-dimethyl-4-nitrobenzoic acid |
InChI | InChI=1S/C9H9NO4/c1-5-4-8(10(13)14)6(2)3-7(5)9(11)12/h3-4H,1-2H3,(H,11,12) |
InChIKey | WQJLIVQRJOLTMH-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])C)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |