For research use only. Not for therapeutic Use.
2,5-Dioxopyrrolidin-1-yl hept-6-ynoate(CAT: L003378), a pyrrolidinone derivative with a hept-6-ynoate substituent, holds significance in pharmaceutical and organic chemistry. Its pyrrolidinone core introduces potential interactions with biological targets, making it relevant for drug development. In pharmaceutical research, it could be explored for its effects on enzymatic pathways or receptors, potentially impacting therapeutic pathways. The hept-6-ynoate moiety offers opportunities for chemical modifications, crucial for fine-tuning properties or creating derivatives.
CAS Number | 917222-23-2 |
Molecular Formula | C11H13NO4 |
Purity | ≥95% |
IUPAC Name | (2,5-dioxopyrrolidin-1-yl) hept-6-ynoate |
InChI | InChI=1S/C11H13NO4/c1-2-3-4-5-6-11(15)16-12-9(13)7-8-10(12)14/h1H,3-8H2 |
InChIKey | KENPLOYECFEPSG-UHFFFAOYSA-N |
SMILES | C#CCCCCC(=O)ON1C(=O)CCC1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |