For research use only. Not for therapeutic Use.
2,5-Dipropoxyterephthalaldehyde (Cat.No:L004028) is a vital compound in organic synthesis. Its unique structure, featuring propoxy groups on a terephthalaldehyde backbone, imparts distinctive reactivity and properties. This compound is employed as a valuable building block in the creation of specialized molecules for various industrial applications.
CAS Number | 245116-57-8 |
Molecular Formula | C14H18O4 |
Purity | ≥95% |
IUPAC Name | 2,5-dipropoxyterephthalaldehyde |
InChI | InChI=1S/C14H18O4/c1-3-5-17-13-7-12(10-16)14(18-6-4-2)8-11(13)9-15/h7-10H,3-6H2,1-2H3 |
InChIKey | IYVCKZLBCVNHFV-UHFFFAOYSA-N |
SMILES | CCCOC1=CC(=C(C=C1C=O)OCCC)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |