For research use only. Not for therapeutic Use.
2,5-Furandicarboxylic Acid Diethyl Ester is a versatile chemical intermediate, essential for advanced polymer and material science research. This compound is used in the synthesis of biodegradable polymers and renewable materials, playing a crucial role in sustainable chemistry. Its unique properties enable the development of eco-friendly plastics and high-performance materials. 2,5-Furandicarboxylic Acid Diethyl Ester is highly valued for its purity and stability, making it an indispensable tool for researchers focused on innovative and sustainable solutions in material science.
| Catalog Number | R006707 |
| CAS Number | 53662-83-2 |
| Synonyms | Furan-2,5-dicarboxylic Acid Diethyl Ester; |
| Molecular Formula | C10H12O5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | diethyl furan-2,5-dicarboxylate |
| InChI | InChI=1S/C10H12O5/c1-3-13-9(11)7-5-6-8(15-7)10(12)14-4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | PHGMGTWRSNXLDV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(O1)C(=O)OCC |
