For research use only. Not for therapeutic Use.
2,5-Hexanediol（Cat No.:R070637）is a six-carbon diol featuring hydroxyl groups at the 2 and 5 positions. It is commonly used as a solvent, plasticizer, and intermediate in the production of polymers, resins, and coatings. Its bifunctional nature allows for versatile reactivity, making it suitable for a variety of chemical transformations. In the cosmetic industry, 2,5-hexanediol is used as a moisturizer and preservative due to its hydrophilic properties. It is also valuable in pharmaceutical and industrial applications, where it aids in enhancing the properties of products and formulations.
| Catalog Number | R070637 |
| CAS Number | 2935-44-6 |
| Synonyms | 2.5-Hexylene glycol |
| Molecular Formula | C6H14O2 |
| Purity | ≥95% |
| IUPAC Name | hexane-2,5-diol |
| InChI | InChI=1S/C6H14O2/c1-5(7)3-4-6(2)8/h5-8H,3-4H2,1-2H3 |
| InChIKey | OHMBHFSEKCCCBW-UHFFFAOYSA-N |
| SMILES | CC(CCC(C)O)O |
