25-Hydroxy VD2-d6(Cat No.:S000549) is an isotopically labeled form of 25-hydroxyvitamin D2, a metabolite of vitamin D involved in various physiological functions such as bone health and immune regulation. The “d6” designation indicates that six hydrogen atoms in the molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling enables precise tracking of the metabolite in biological systems using advanced analytical techniques like mass spectrometry. 25-Hydroxy VD2-d6 serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating vitamin D-related disorders.
Catalog Number | S000549 |
CAS Number | 1262843-46-8 |
Molecular Formula | C28H38D6O2 |
Purity | ≥95% |
IUPAC Name | (1S,3Z)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(E,2R,5S)-7,7,7-trideuterio-6-hydroxy-5-methyl-6-(trideuteriomethyl)hept-3-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
InChI | InChI=1S/C28H44O2/c1-19-10-14-24(29)18-23(19)13-12-22-8-7-17-28(6)25(15-16-26(22)28)20(2)9-11-21(3)27(4,5)30/h9,11-13,20-21,24-26,29-30H,1,7-8,10,14-18H2,2-6H3/b11-9+,22-12+,23-13-/t20-,21+,24+,25-,26+,28-/m1/s1/i4D3,5D3 |
InChIKey | KJKIIUAXZGLUND-SGQRFKNGSA-N |
SMILES | CC(C=CC(C)C(C)(C)O)C1CCC2C1(CCCC2=CC=C3CC(CCC3=C)O)C |