For research use only. Not for therapeutic Use.
2,5-Pyridinedicarboxylic acid di-n-propyl ester(CAT: M069314) is an organic compound derived from pyridine, where the two carboxyl groups at the 2nd and 5th positions of the pyridine ring are esterified with n-propyl groups. This compound is typically used as an intermediate in organic synthesis and can play a role in the production of pharmaceuticals, agrochemicals, or other specialty chemicals. The ester functional groups provide reactivity suitable for various chemical transformations, making it valuable in designing more complex molecules. Its pyridine core also gives it potential utility in coordination chemistry or in developing heterocyclic compounds for research or industrial applications.
CAS Number | 136-45-8 |
Molecular Formula | C13H17NO4 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | dipropyl pyridine-2,5-dicarboxylate |
InChI | InChI=1S/C13H17NO4/c1-3-7-17-12(15)10-5-6-11(14-9-10)13(16)18-8-4-2/h5-6,9H,3-4,7-8H2,1-2H3 |
InChIKey | IITCWRFYJWUUPC-UHFFFAOYSA-N |
SMILES | CCCOC(=O)C1=CN=C(C=C1)C(=O)OCCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |