For research use only. Not for therapeutic Use.
(25R)-26-Hydroxycholesterol(Cat No.:R021972)is a high-purity oxysterol used extensively in biochemical and medical research. It plays a significant role in cholesterol metabolism, acting as a regulatory molecule in lipid homeostasis and inflammatory processes. This compound is crucial for studying the mechanisms of cholesterol transport, synthesis, and its effects on cellular signaling pathways. Its involvement in various physiological processes makes it valuable for exploring therapeutic targets for cardiovascular diseases, neurodegenerative disorders, and cancer. (25R)-26-Hydroxycholesterol is indispensable for advancing research in lipid biology and developing new treatments for related diseases.
CAS Number | 20380-11-4 |
Synonyms | (25R)-Cholest-5-ene-3β,26-diol; (25R)-NSC 226105; (25R)-(3S,8S,9S,10R,13R,14S,17R)-17-((2R)-7-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
Molecular Formula | C27H46O2 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,6R)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
InChI | InChI=1S/C27H46O2/c1-18(17-28)6-5-7-19(2)23-10-11-24-22-9-8-20-16-21(29)12-14-26(20,3)25(22)13-15-27(23,24)4/h8,18-19,21-25,28-29H,5-7,9-17H2,1-4H3/t18-,19-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
InChIKey | FYHRJWMENCALJY-YSQMORBQSA-N |
SMILES | CC(CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |