For research use only. Not for therapeutic Use.
(25R)-3β-(4-O-α-L-Rhamnopyranosyl-β-D-glucopyranosyloxy)spirosta-5-ene(Cat No.:M074795) is a complex natural product belonging to the spirostanol steroid family. It consists of a spirosta-5-ene core structure modified with sugar moieties attached at specific positions. The configuration (25R) indicates the stereochemistry at carbon 25. This compound is found in certain plants, particularly those of the genus Asparagus. It exhibits various biological activities and pharmacological properties, including potential antioxidant, anti-inflammatory, and cytotoxic effects.
CAS Number | 19057-68-2 |
Synonyms | Progenin II; Prosapogenin B of dioscin; |
Molecular Formula | C39H62O12 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[4,5-dihydroxy-2-(hydroxymethyl)-6-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
InChI | InChI=1S/C39H62O12/c1-18-8-13-39(46-17-18)19(2)28-26(51-39)15-25-23-7-6-21-14-22(9-11-37(21,4)24(23)10-12-38(25,28)5)48-36-33(45)31(43)34(27(16-40)49-36)50-35-32(44)30(42)29(41)20(3)47-35/h6,18-20,22-36,40-45H,7-17H2,1-5H3 |
InChIKey | ZUMDKMTZYHACBK-UHFFFAOYSA-N |
SMILES | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)O)C)C)C)OC1 |