For research use only. Not for therapeutic Use.
(25R)-3β,26-Dihydroxy-5α-furost-20(22)-en-12-one is a high-purity compound widely used in pharmaceutical and biochemical research. This furostanol derivative is essential for studying steroidal saponins and their biological activities. It plays a crucial role in developing therapeutic agents and understanding their mechanisms of action. Ideal for researchers focusing on natural product chemistry and drug discovery, it ensures precise and reliable results in experimental setups, making it invaluable for advancing pharmaceutical research and developing new treatments.
| Catalog Number | M062589 |
| CAS Number | 11005-20-2 |
| Molecular Formula | C27H42O4 |
| Purity | ≥95% |
| Documentation | |
| Storage | Store at -20°C |
| InChI | InChI=1S/C27H42O4/c1-15(14-28)5-8-22-16(2)25-23(31-22)12-21-19-7-6-17-11-18(29)9-10-26(17,3)20(19)13-24(30)27(21,25)4/h15,17-21,23,25,28-29H,5-14H2,1-4H3/t15-,17+,18+,19-,20+,21+,23+,25+,26+,27-/m1/s1 |
| InChIKey | YHGXHXTZNBXLKF-RVKDJADKSA-N |
| SMILES | CC1=C(OC2C1C3(C(C2)C4CCC5CC(CCC5(C4CC3=O)C)O)C)CCC(C)CO |
