For research use only. Not for therapeutic Use.
2,6-Bis(2-benzimidazolyl)pyridine is a versatile ligand widely utilized in coordination chemistry and catalysis. This compound features a pyridine core substituted with two benzimidazole groups, enhancing its ability to form stable complexes with various metal ions. Its unique structure promotes interesting electronic properties and reactivity, making it valuable in developing catalysts for organic synthesis and in the fields of materials science and medicinal chemistry. Additionally, its potential applications in sensors and molecular recognition are actively explored.
Catalog Number | R065412 |
CAS Number | 28020-73-7 |
Molecular Formula | C19H13N5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[6-(1H-benzimidazol-2-yl)pyridin-2-yl]-1H-benzimidazole |
InChI | InChI=1S/C19H13N5/c1-2-7-13-12(6-1)21-18(22-13)16-10-5-11-17(20-16)19-23-14-8-3-4-9-15(14)24-19/h1-11H,(H,21,22)(H,23,24) |
InChIKey | JBKICBDXAZNSKA-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)NC(=N2)C3=NC(=CC=C3)C4=NC5=CC=CC=C5N4 |