For research use only. Not for therapeutic Use.
2,6-Bis[(4S)-benzyl-2-oxazolin-2-yl]pyridine(Cat No.:L006716), is a chemical compound featuring a pyridine ring substituted with two (4S)-benzyl-2-oxazolin-2-yl groups. This compound is significant in coordination chemistry, often used as a ligand in various metal-catalyzed reactions. The unique structure of this ligand imparts specific reactivity, making it valuable in asymmetric catalysis and organic synthesis. Researchers utilize 2,6-Bis[(4S)-benzyl-2-oxazolin-2-yl]pyridine in the development of chiral catalysts, facilitating the creation of enantioselective reactions, contributing significantly to advancements in the field of catalysis and enabling the synthesis of complex chiral molecules.
Catalog Number | L006716 |
CAS Number | 151670-69-8 |
Molecular Formula | C25H23N3O2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | (4S)-4-benzyl-2-[6-[(4S)-4-benzyl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-2-yl]-4,5-dihydro-1,3-oxazole |
InChI | InChI=1S/C25H23N3O2/c1-3-8-18(9-4-1)14-20-16-29-24(26-20)22-12-7-13-23(28-22)25-27-21(17-30-25)15-19-10-5-2-6-11-19/h1-13,20-21H,14-17H2/t20-,21-/m0/s1 |
InChIKey | ZBONTXCYJLVGLR-SFTDATJTSA-N |
SMILES | C1C(N=C(O1)C2=NC(=CC=C2)C3=NC(CO3)CC4=CC=CC=C4)CC5=CC=CC=C5 |