For research use only. Not for therapeutic Use.
2,6-Bis(chloromethyl)naphthalene(Cat No.:L015916)is a specialized organic compound commonly used as an intermediate in the synthesis of advanced materials and pharmaceutical compounds. This naphthalene derivative, featuring two chloromethyl groups at the 2 and 6 positions, is crucial for constructing complex molecular architectures, including polymers, resins, and other specialty chemicals. Its high reactivity makes it suitable for cross-coupling reactions and other synthetic transformations. With consistent quality and purity, 2,6-Bis(chloromethyl)naphthalene is an essential building block in various chemical and pharmaceutical research applications.
CAS Number | 93036-77-2 |
Molecular Formula | C12H10Cl2 |
Purity | ≥95% |
IUPAC Name | 2,6-bis(chloromethyl)naphthalene |
InChI | InChI=1S/C12H10Cl2/c13-7-9-1-3-11-6-10(8-14)2-4-12(11)5-9/h1-6H,7-8H2 |
InChIKey | RGAMXQRIMZYOPM-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC(=C2)CCl)C=C1CCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |