Home
>
Catalysts and Ligands>Chiral nitrogen ligands> 2,6-Bis((R)-4-methyl-4,5-dihydrooxazol-2-yl)pyridine
For research use only. Not for therapeutic Use.
2,6-Bis((R)-4-methyl-4,5-dihydrooxazol-2-yl)pyridine (Cat.No:L003408) is a crucial chiral ligand employed in asymmetric synthesis. Its specific configuration imparts exceptional stereocontrol in various chemical reactions, making it invaluable in the production of enantiopure compounds. Widely utilized in pharmaceutical and agrochemical industries, this compound plays a pivotal role in the development of advanced and efficient synthetic methodologies.
CAS Number | 256377-24-9 |
Molecular Formula | C13H15N3O2 |
Purity | ≥95% |
IUPAC Name | (4R)-4-methyl-2-[6-[(4R)-4-methyl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-2-yl]-4,5-dihydro-1,3-oxazole |
InChI | InChI=1S/C13H15N3O2/c1-8-6-17-12(14-8)10-4-3-5-11(16-10)13-15-9(2)7-18-13/h3-5,8-9H,6-7H2,1-2H3/t8-,9-/m1/s1 |
InChIKey | UHXIDHCQNRFIHV-RKDXNWHRSA-N |
SMILES | C[C@@H]1COC(=N1)C2=NC(=CC=C2)C3=N[C@@H](CO3)C |