For research use only. Not for therapeutic Use.
26-Deoxymonensin A is a derivative of the antibiotic monensin, produced by Streptomyces bacteria. It functions as an ionophore, facilitating the transport of ions across cellular membranes. This compound is studied for its antimicrobial and anticancer properties, offering potential therapeutic applications. Its unique structure and ability to disrupt ion gradients make it valuable in pharmaceutical and biochemical research.
CAS Number | 122576-59-4 |
Synonyms | 1,6-Dioxaspiro[4.5]decane Monensin deriv.; 26-Deoxymonensin |
Molecular Formula | C36H62O10 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-[2-[5-ethyl-5-[5-(6-hydroxy-3,5,6-trimethyloxan-2-yl)-3-methyloxolan-2-yl]oxolan-2-yl]-7-hydroxy-2,8-dimethyl-1,10-dioxaspiro[4.5]decan-9-yl]-3-methoxy-2-methylpentanoic acid |
InChI | InChI=1S/C36H62O10/c1-11-35(31-20(3)17-26(42-31)28-19(2)16-21(4)34(9,40)44-28)13-12-27(43-35)33(8)14-15-36(46-33)18-25(37)22(5)30(45-36)23(6)29(41-10)24(7)32(38)39/h19-31,37,40H,11-18H2,1-10H3,(H,38,39) |
InChIKey | GORGDRGXUKJXOM-UHFFFAOYSA-N |
SMILES | CCC1(CCC(O1)C2(CCC3(O2)CC(C(C(O3)C(C)C(C(C)C(=O)O)OC)C)O)C)C4C(CC(O4)C5C(CC(C(O5)(C)O)C)C)C |