For research use only. Not for therapeutic Use.
2,6-Di-tert-butyl-4-methylene-2,5-cyclohexadienone(Cat No.:M019482) is a synthetic organic molecule characterized by its robust and reactive structural features. The compound has a cyclohexadiene ring, a type of aromatic ring with oxygen functionality, and includes additional methylene (-CH2-) and tert-butyl groups. These substituents enhance the molecule’s steric hindrance and stability, making it less prone to unwanted side reactions. It’s utilized in organic chemistry for its properties as an intermediate in synthesizing more complex molecules. The presence of tert-butyl groups also affects its solubility and reactivity, making it a versatile tool for designing specific chemical reactions.
CAS Number | 2607-52-5 |
Synonyms | 2,6-di-tert-butyl-4-methylene-2,5-cyclohexadienone;2,6-DI-TERT-BUTYL-4-METHYLENECYCLOHEXA-2,5-DIENONE;BHTQUINONEMETHIDE;Everolimus Related Compound 5;2,5-Cyclohexadien- 1-one,2,6-bis(1,1-dimethylethyl)-4-methylene |
Molecular Formula | C15H22O |
Purity | ≥95% |
Storage | <label class= |
IUPAC Name | 2,6-ditert-butyl-4-methylidenecyclohexa-2,5-dien-1-one |
InChI | InChI=1S/C15H22O/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7/h8-9H,1H2,2-7H3 |
InChIKey | JJQCWPWUHZFKBN-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC(=C)C=C(C1=O)C(C)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |