BHT is a widely used synthetic antioxidant found in all types of manufactured items, from foodstuffs, to cosmetics, to rubber, and paint.
| Catalog Number | R050452 |
| CAS Number | 128-37-0 |
| Synonyms | 2,6-Bis(1,1-dimethylethyl)-4-methylphenol; 2,6-Di(tert-butyl)hydroxytoluene; 2,6-Di-tert-butyl-4-hydroxytoluene; 2,6-Ditertbutyl Paracresol; 4-Methyl-2,6-bis(1,1-?dimethylethyl)phenol; Advastab 401; Dalpac; Deenax; Impruvol; Ionol; Topanol; BHT |
| Molecular Formula | C15H24O |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol |
| InChI | InChI=1S/C15H24O/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7/h8-9,16H,1-7H3 |
| InChIKey | NLZUEZXRPGMBCV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
