2,6-Di(1H-pyrazol-3-yl)pyridine(CAT: L000078) is a notable compound with relevance in organic chemistry and material science. This chemical features a pyridine ring substituted with two 1H-pyrazol-3-yl groups. It is frequently used as a key intermediate in the synthesis of various organic compounds, particularly in the development of advanced materials and specialty polymers.
| Catalog Number | L000078 |
| CAS Number | 63285-53-0 |
| Molecular Formula | C11H9N5 |
| Purity | ≥95% |
| IUPAC Name | 2,6-bis(1H-pyrazol-5-yl)pyridine |
| InChI | InChI=1S/C11H9N5/c1-2-8(10-4-6-12-15-10)14-9(3-1)11-5-7-13-16-11/h1-7H,(H,12,15)(H,13,16) |
| InChIKey | WEHSLQMKHNECMN-UHFFFAOYSA-N |
