For research use only. Not for therapeutic Use.
2,6-Diacetylpyridine(Cat No.:M050705) is an organic compound derived from pyridine, characterized by the presence of acetyl groups attached at the 2 and 6 positions of the pyridine ring. This yellow crystalline solid is primarily used in the field of coordination chemistry as a versatile ligand for synthesizing metal complexes. These complexes often exhibit interesting optical, magnetic, and catalytic properties, making them useful in various applications including catalysis and materials science. Additionally, 2,6-diacetyl pyridine serves as an intermediate in organic synthesis, particularly in the creation of heterocyclic compounds and pharmaceuticals.
CAS Number | 1129-30-2 |
Molecular Formula | C9H9NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(6-acetylpyridin-2-yl)ethanone |
InChI | InChI=1S/C9H9NO2/c1-6(11)8-4-3-5-9(10-8)7(2)12/h3-5H,1-2H3 |
InChIKey | BEZVGIHGZPLGBL-UHFFFAOYSA-N |
SMILES | CC(=O)C1=NC(=CC=C1)C(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |