For research use only. Not for therapeutic Use.
2,6-Diaminonicotinonitrile is a heterocyclic compound featuring a pyridine ring with amino groups at the 2 and 6 positions and a cyano group at the 3 position. This unique arrangement enhances its reactivity and potential as a versatile building block in organic synthesis. It is of interest in pharmaceutical research due to its potential biological activities, including antimicrobial and anticancer properties. The compound’s structure may enable the design of novel therapeutic agents and contribute to advancements in medicinal chemistry.
| Catalog Number | L020367 |
| CAS Number | 99761-27-0 |
| Molecular Formula | C6H6N4 |
| Purity | ≥95% |
| IUPAC Name | 2,6-diaminopyridine-3-carbonitrile |
| InChI | InChI=1S/C6H6N4/c7-3-4-1-2-5(8)10-6(4)9/h1-2H,(H4,8,9,10) |
| InChIKey | JOYHAQAJGKHSGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C#N)N)N |
