For research use only. Not for therapeutic Use.
2,6-Dichloro-4-methylbenzaldehyde(Cat No.:M134408)is a specialized aromatic compound widely used in pharmaceutical and chemical research. Featuring two chlorine atoms and a methyl group attached to a benzaldehyde core, this compound is an important intermediate in the synthesis of various complex molecules. Its unique structure enables diverse chemical modifications, making it valuable in the development of new drugs, agrochemicals, and fine chemicals. 2,6-Dichloro-4-methylbenzaldehyde plays a crucial role in high-precision synthesis, supporting innovative research and advancements in medicinal chemistry.
CAS Number | 116070-31-6 |
Synonyms | 2,6-DICHLORO-4-METHYLBENZALDEHYDE |
Molecular Formula | C8H6Cl2O |
Purity | ≥95% |
IUPAC Name | 2,6-dichloro-4-methylbenzaldehyde |
InChI | InChI=1S/C8H6Cl2O/c1-5-2-7(9)6(4-11)8(10)3-5/h2-4H,1H3 |
InChIKey | AACXQAPPAREFQR-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C(=C1)Cl)C=O)Cl |