For research use only. Not for therapeutic Use.
2,6-Dichloro-4-nitrobenzo[d]thiazole(CAT: L000295) is a compound of significance in material and organic chemistry. This chemical is used in the synthesis of organic compounds and materials. Its action method involves serving as a key building block for the creation of various organic molecules and materials. In material chemistry, it is crucial for designing functional materials with tailored properties, making it valuable for scientists and engineers working on advanced material development.
CAS Number | 1379329-41-5 |
Molecular Formula | C7H2Cl2N2O2S |
Purity | ≥95% |
IUPAC Name | 2,6-dichloro-4-nitro-1,3-benzothiazole |
InChI | InChI=1S/C7H2Cl2N2O2S/c8-3-1-4(11(12)13)6-5(2-3)14-7(9)10-6/h1-2H |
InChIKey | VBXOKINKCGFIAF-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |