For research use only. Not for therapeutic Use.
2,6-Dichloro-8,9-dimethyl-9H-purine(Cat No.:L025897)is a valuable compound in pharmaceutical research and chemical synthesis. Its purine core, substituted with chlorine atoms and methyl groups, makes it an important intermediate in the development of various therapeutic agents, particularly antiviral and anticancer drugs. The dichloro groups enhance its reactivity, allowing for selective modifications and functionalization in complex molecular synthesis. With high purity and stability, this compound supports advanced research in medicinal chemistry, facilitating the design and synthesis of innovative bioactive molecules for drug discovery.
CAS Number | 1474018-06-8 |
Molecular Formula | C7H6Cl2N4 |
Purity | ≥95% |
IUPAC Name | 2,6-dichloro-8,9-dimethylpurine |
InChI | InChI=1S/C7H6Cl2N4/c1-3-10-4-5(8)11-7(9)12-6(4)13(3)2/h1-2H3 |
InChIKey | ROQDXPSEHZRJGV-UHFFFAOYSA-N |
SMILES | CC1=NC2=C(N1C)N=C(N=C2Cl)Cl |