For research use only. Not for therapeutic Use.
2,6-Dichloro-N-(4-chlorophenyl)benzeneacetamide (Cat.No:R042516) is a chemical compound employed in research and chemical synthesis. Its unique structure features dichloro and chlorophenyl groups attached to a benzeneacetamide backbone. This compound’s diverse applications span pharmaceuticals, agrochemicals, and material science, making it a valuable tool in chemical research.
CAS Number | 560075-65-2 |
Synonyms | Diclofenac Impurity F |
Molecular Formula | C14H10Cl3NO |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | N-(4-chlorophenyl)-2-(2,6-dichlorophenyl)acetamide |
InChI | InChI=1S/C14H10Cl3NO/c15-9-4-6-10(7-5-9)18-14(19)8-11-12(16)2-1-3-13(11)17/h1-7H,8H2,(H,18,19) |
InChIKey | PZQRCZHTCCSTFP-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)Cl)CC(=O)NC2=CC=C(C=C2)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |