For research use only. Not for therapeutic Use.
2,6-Dichloroquinoline-4-carbonitrile(Cat No.:L007385), is a key compound in the field of organic chemistry. This heterocyclic aromatic compound features a quinoline ring system with chlorine substituents at positions 2 and 6 and a cyano group at position 4. The unique structure of this molecule makes it valuable in the synthesis of various biologically active compounds and pharmaceuticals. Its applications extend to the development of agrochemicals and materials in addition to its role as an intermediate in organic synthesis. Researchers utilize this compound as a building block to create complex molecules, enabling advancements in drug discovery and chemical research.
CAS Number | 50504-14-8 |
Molecular Formula | C10H4Cl2N2 |
Purity | ≥95% |
IUPAC Name | 2,6-dichloroquinoline-4-carbonitrile |
InChI | InChI=1S/C10H4Cl2N2/c11-7-1-2-9-8(4-7)6(5-13)3-10(12)14-9/h1-4H |
InChIKey | FARGULUBVYWUNI-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1Cl)C(=CC(=N2)Cl)C#N |