For research use only. Not for therapeutic Use.
2,6-Dichloroquinone-4-chloroimide is a chemical reagent known for its use in organic synthesis and analytical chemistry. It features two chlorine atoms on the quinone ring and an additional chlorine on the imide group. This compound is often employed in detecting phenols and amines, making it valuable in various chemical analysis and research applications.
Catalog Number | R039527 |
CAS Number | 101-38-2 |
Synonyms | 2,6-Dichloro-4-(chloroimino)cyclohexa-2,5-dienone; 2,6-Dichloro-4-N-chloroquinonimine; 2,6-Dichloro-4-chloroimino-2,5-cyclohexadien-1-one; 2,6-Dichloro-p-benzoquinone-4-chlorimide; 2,6-Dichlorobenzoquinone N-Chloroimine; 2,6-Dichlorobenzoquinone Chlo |
Molecular Formula | C6H2Cl3NO |
Purity | 98% |
Storage | Store at -20°C |
Related CAS | 697-91-6 615-93-0 7255-28-9 7791-25-5 |
IUPAC Name | 2,6-dichloro-4-chloroiminocyclohexa-2,5-dien-1-one |
InChI | InChI=1S/C6H2Cl3NO/c7-4-1-3(10-9)2-5(8)6(4)11/h1-2H |
InChIKey | YHUMTHWQGWPJOQ-UHFFFAOYSA-N |
SMILES | C1=C(C(=O)C(=CC1=NCl)Cl)Cl |