For research use only. Not for therapeutic Use.
2,6-Diethyl-4-methylaniline(CAT: L041822) is an aromatic amine with two ethyl groups at the 2 and 6 positions and a methyl group at the 4 position on the benzene ring, along with an amino group (-NH₂) attached to the ring. This compound is used as an intermediate in organic synthesis, particularly for producing dyes, agrochemicals, and pharmaceuticals. The presence of the ethyl and methyl substituents increases the compound’s lipophilicity, while the amino group allows for various modifications through acylation or alkylation reactions. Its structure makes it suitable for applications in designing molecules with desired chemical and biological properties, such as enhanced solubility and selective reactivity in target compounds.
CAS Number | 24544-08-9 |
Molecular Formula | C11H17N |
Purity | ≥95% |
IUPAC Name | 2,6-diethyl-4-methylaniline |
InChI | InChI=1S/C11H17N/c1-4-9-6-8(3)7-10(5-2)11(9)12/h6-7H,4-5,12H2,1-3H3 |
InChIKey | OIXUMNZGNCAOKY-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |