For research use only. Not for therapeutic Use.
2,6-Diethylbenzoic Acid(CAT: M347472) is a high-purity aromatic carboxylic acid widely employed in pharmaceutical, agrochemical, and material science research. Featuring two ethyl groups at the ortho positions of the benzene ring, this compound exhibits unique steric and electronic properties, making it a valuable intermediate in the synthesis of advanced organic molecules. Its robust chemical stability and reactivity are ideal for crafting complex derivatives, facilitating the development of novel drugs, catalysts, and polymers. 2,6-Diethylbenzoic Acid supports diverse applications with consistent performance, ensuring reliable outcomes in both academic and industrial research settings.
CAS Number | 78114-07-5 |
Molecular Formula | C11H14O2 |
Purity | ≥95% |
IUPAC Name | 2,6-diethylbenzoic acid |
InChI | InChI=1S/C11H14O2/c1-3-8-6-5-7-9(4-2)10(8)11(12)13/h5-7H,3-4H2,1-2H3,(H,12,13) |
InChIKey | NIHOKFPCYMIIGM-UHFFFAOYSA-N |
SMILES | CCC1=C(C(=CC=C1)CC)C(=O)O |