For research use only. Not for therapeutic Use.
2,6-Difluoro-4-hydrazinylpyridine is a pyridine derivative characterized by hydrazine and difluoro substituents. This compound is significant in medicinal chemistry due to its potential biological activities, including antitumor and antibacterial properties. The hydrazinyl group can facilitate various reactions, enhancing its utility as a building block in organic synthesis. Its unique structure allows for further modifications, making it a valuable intermediate for developing novel therapeutic agents and exploring applications in drug discovery and materials science.
Catalog Number | L028673 |
CAS Number | 837364-94-0 |
Molecular Formula | C5H5F2N3 |
Purity | ≥95% |
IUPAC Name | (2,6-difluoropyridin-4-yl)hydrazine |
InChI | InChI=1S/C5H5F2N3/c6-4-1-3(10-8)2-5(7)9-4/h1-2H,8H2,(H,9,10) |
InChIKey | YDUYJJIXZAXMIJ-UHFFFAOYSA-N |
SMILES | C1=C(C=C(N=C1F)F)NN |