For research use only. Not for therapeutic Use.
2,6-Difluoro-4-(hydroxymethyl)benzoic acid(Cat No.:L007718), is a chemical compound featuring a benzoic acid core substituted with difluoromethyl and hydroxymethyl groups at specific positions. This structure is significant in medicinal chemistry and organic synthesis. Researchers use it as a crucial intermediate for the synthesis of various organic compounds, particularly in the development of pharmaceuticals. Its applications include drug discovery, where it serves as a key building block for potential therapeutic agents. The compound’s unique functional groups make it valuable for the creation of diverse bioactive molecules, contributing significantly to advancements in medicinal chemistry research and drug development.
CAS Number | 1378805-89-0 |
Molecular Formula | C8H6F2O3 |
Purity | ≥95% |
IUPAC Name | 2,6-difluoro-4-(hydroxymethyl)benzoic acid |
InChI | InChI=1S/C8H6F2O3/c9-5-1-4(3-11)2-6(10)7(5)8(12)13/h1-2,11H,3H2,(H,12,13) |
InChIKey | SNTDYLMRIMBQKP-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1F)C(=O)O)F)CO |